C30H25ClN4O3S — CID 19312302
N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312302) has the molecular formula C30H25ClN4O3S and a molecular weight of 557.08 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312302 |
| Molecular Formula | C30H25ClN4O3S |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C/c3cccnc3)NC(=O)c3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C30H25ClN4O3S/c1-20-12-13-24(17-26(20)31)33-28(36)19-39-25-11-5-10-23(16-25)34-30(38)27(15-21-7-6-14-32-18-21)35-29(37)22-8-3-2-4-9-22/h2-18H,19H2,1H3,(H,33,36)(H,34,38)(H,35,37)/b27-15- |
| InChIKey | YJSCVRADUVAVFB-DICXZTSXSA-N |
| XLogP | 6.18 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|