C28H21Cl2N3O3S2 — CID 19312883
N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19312883) has the molecular formula C28H21Cl2N3O3S2 and a molecular weight of 582.53 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312883 |
| Molecular Formula | C28H21Cl2N3O3S2 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.04 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H21Cl2N3O3S2/c29-23-12-11-20(15-24(23)30)31-26(34)17-38-21-9-4-8-19(14-21)32-28(36)25(16-22-10-5-13-37-22)33-27(35)18-6-2-1-3-7-18/h1-16H,17H2,(H,31,34)(H,32,36)(H,33,35)/b25-16- |
| InChIKey | CIXJVCATBJXEMO-XYGWBWBKSA-N |
| XLogP | 7.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|