C35H26ClN3O5S2 — CID 19313065
5-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid (PubChem CID 19313065) has the molecular formula C35H26ClN3O5S2 and a molecular weight of 668.20 g/mol. Its IUPAC name is 5-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19313065 |
| Molecular Formula | C35H26ClN3O5S2 |
| Molecular Weight | 668.20 g/mol |
| Exact Mass | 667.10 |
| IUPAC Name | 5-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Cl)c(C(=O)O)c2)c2ccccc2)c1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H26ClN3O5S2/c36-29-17-16-25(20-28(29)35(43)44)38-34(42)31(22-9-3-1-4-10-22)46-27-14-7-13-24(19-27)37-33(41)30(21-26-15-8-18-45-26)39-32(40)23-11-5-2-6-12-23/h1-21,31H,(H,37,41)(H,38,42)(H,39,40)(H,43,44)/b30-21- |
| InChIKey | QZAAPNYJNPOSFK-OFWBYEQRSA-N |
| XLogP | 7.98 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.20 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|