C35H27N3O5S2 — CID 22189541
3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 22189541) has the molecular formula C35H27N3O5S2 and a molecular weight of 633.75 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22189541 |
| Molecular Formula | C35H27N3O5S2 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2cccc(C(=O)O)c2)c2ccccc2)cc1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H27N3O5S2/c39-32(24-11-5-2-6-12-24)38-30(22-29-15-8-20-44-29)33(40)36-26-16-18-28(19-17-26)45-31(23-9-3-1-4-10-23)34(41)37-27-14-7-13-25(21-27)35(42)43/h1-22,31H,(H,36,40)(H,37,41)(H,38,39)(H,42,43)/b30-22- |
| InChIKey | IUMCYCOAGIRKDU-SWKFRHMKSA-N |
| XLogP | 7.33 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|