C34H25ClFN3O3S2 — CID 22189493
N-[(Z)-3-[4-[2-(3-chloro-4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 22189493) has the molecular formula C34H25ClFN3O3S2 and a molecular weight of 642.18 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-chloro-4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-chloro-4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189493 |
| Molecular Formula | C34H25ClFN3O3S2 |
| Molecular Weight | 642.18 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-chloro-4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(F)c(Cl)c2)c2ccccc2)cc1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H25ClFN3O3S2/c35-28-20-25(15-18-29(28)36)38-34(42)31(22-8-3-1-4-9-22)44-26-16-13-24(14-17-26)37-33(41)30(21-27-12-7-19-43-27)39-32(40)23-10-5-2-6-11-23/h1-21,31H,(H,37,41)(H,38,42)(H,39,40)/b30-21- |
| InChIKey | QXAYPIDPOXTVMT-OFWBYEQRSA-N |
| XLogP | 8.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.18 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|