C40H31N3O4S2 — CID 19313063
N-[(Z)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19313063) has the molecular formula C40H31N3O4S2 and a molecular weight of 681.84 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313063 |
| Molecular Formula | C40H31N3O4S2 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)c1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H31N3O4S2/c44-38(29-14-6-2-7-15-29)43-36(27-34-20-11-25-48-34)39(45)42-31-16-10-19-35(26-31)49-37(28-12-4-1-5-13-28)40(46)41-30-21-23-33(24-22-30)47-32-17-8-3-9-18-32/h1-27,37H,(H,41,46)(H,42,45)(H,43,44)/b36-27- |
| InChIKey | FKOIHBBUOXGYKL-RLANJUCJSA-N |
| XLogP | 9.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|