C44H37N3O6S — CID 19307591
N-[(E)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19307591) has the molecular formula C44H37N3O6S and a molecular weight of 735.86 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307591 |
| Molecular Formula | C44H37N3O6S |
| Molecular Weight | 735.86 g/mol |
| Exact Mass | 735.24 |
| IUPAC Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(Oc4ccccc4)cc3)c3ccccc3)c2)c1OC |
| InChI | InChI=1S/C44H37N3O6S/c1-51-39-23-12-18-32(40(39)52-2)28-38(47-42(48)31-16-8-4-9-17-31)43(49)46-34-19-13-22-37(29-34)54-41(30-14-6-3-7-15-30)44(50)45-33-24-26-36(27-25-33)53-35-20-10-5-11-21-35/h3-29,41H,1-2H3,(H,45,50)(H,46,49)(H,47,48)/b38-28+ |
| InChIKey | RNDMTDSJPYENRO-HXPUERGNSA-N |
| XLogP | 9.38 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.86 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|