C39H35N3O6S — CID 21385568
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385568) has the molecular formula C39H35N3O6S and a molecular weight of 673.79 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385568 |
| Molecular Formula | C39H35N3O6S |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3cccc(OC)c3OC)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H35N3O6S/c1-46-31-21-17-29(18-22-31)41-39(45)36(26-11-6-4-7-12-26)49-32-23-19-30(20-24-32)40-38(44)33(42-37(43)27-13-8-5-9-14-27)25-28-15-10-16-34(47-2)35(28)48-3/h4-25,36H,1-3H3,(H,40,44)(H,41,45)(H,42,43)/b33-25- |
| InChIKey | YNCLCTXEEPJNDC-IVQJCJPDSA-N |
| XLogP | 7.59 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|