C43H35N3O5S — CID 22186596
N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22186596) has the molecular formula C43H35N3O5S and a molecular weight of 705.84 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22186596 |
| Molecular Formula | C43H35N3O5S |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(Oc4ccccc4)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H35N3O5S/c1-50-35-23-17-30(18-24-35)29-39(46-41(47)32-13-7-3-8-14-32)42(48)44-34-21-27-38(28-22-34)52-40(31-11-5-2-6-12-31)43(49)45-33-19-25-37(26-20-33)51-36-15-9-4-10-16-36/h2-29,40H,1H3,(H,44,48)(H,45,49)(H,46,47)/b39-29- |
| InChIKey | MTEMHSYWTGEXAS-RGINJTCGSA-N |
| XLogP | 9.37 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|