C39H34N4O5S — CID 22187024
N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22187024) has the molecular formula C39H34N4O5S and a molecular weight of 670.79 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187024 |
| Molecular Formula | C39H34N4O5S |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(NC(C)=O)cc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C39H34N4O5S/c1-26(44)40-30-16-18-31(19-17-30)42-39(47)36(28-11-5-3-6-12-28)49-34-22-20-32(21-23-34)41-38(46)35(25-27-10-9-15-33(24-27)48-2)43-37(45)29-13-7-4-8-14-29/h3-25,36H,1-2H3,(H,40,44)(H,41,46)(H,42,47)(H,43,45)/b35-25- |
| InChIKey | RXJHNBBBQSIHIR-CKWSZQMZSA-N |
| XLogP | 7.54 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|