C37H30FN3O4S — CID 19309600
N-[(Z)-3-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309600) has the molecular formula C37H30FN3O4S and a molecular weight of 631.73 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309600 |
| Molecular Formula | C37H30FN3O4S |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | N-[(Z)-3-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(F)cc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C37H30FN3O4S/c1-45-31-16-8-10-25(22-31)23-33(41-35(42)27-13-6-3-7-14-27)36(43)40-30-15-9-17-32(24-30)46-34(26-11-4-2-5-12-26)37(44)39-29-20-18-28(38)19-21-29/h2-24,34H,1H3,(H,39,44)(H,40,43)(H,41,42)/b33-23- |
| InChIKey | SSBKPJMTPSIGEG-SNCSUOKWSA-N |
| XLogP | 7.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|