C38H33N3O5S — CID 19304985
N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304985) has the molecular formula C38H33N3O5S and a molecular weight of 643.77 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304985 |
| Molecular Formula | C38H33N3O5S |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(NC(=O)C(Sc2cccc(NC(=O)/C(=C/c3ccccc3)NC(=O)c3ccccc3)c2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C38H33N3O5S/c1-45-31-22-30(23-32(25-31)46-2)40-38(44)35(27-15-8-4-9-16-27)47-33-20-12-19-29(24-33)39-37(43)34(21-26-13-6-3-7-14-26)41-36(42)28-17-10-5-11-18-28/h3-25,35H,1-2H3,(H,39,43)(H,40,44)(H,41,42)/b34-21- |
| InChIKey | JVFBYRSOAIWUGE-ZXSNDDASSA-N |
| XLogP | 7.59 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|