C40H34N4O5S — CID 19315929
N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315929) has the molecular formula C40H34N4O5S and a molecular weight of 682.80 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315929 |
| Molecular Formula | C40H34N4O5S |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(NC(=O)C(Sc2cccc(NC(=O)/C(=C/c3c[nH]c4ccccc34)NC(=O)c3ccccc3)c2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C40H34N4O5S/c1-48-31-21-30(22-32(24-31)49-2)43-40(47)37(26-12-5-3-6-13-26)50-33-17-11-16-29(23-33)42-39(46)36(44-38(45)27-14-7-4-8-15-27)20-28-25-41-35-19-10-9-18-34(28)35/h3-25,37,41H,1-2H3,(H,42,46)(H,43,47)(H,44,45)/b36-20- |
| InChIKey | UUYMVHOTRVJMAX-QJOVZPHJSA-N |
| XLogP | 8.07 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|