C34H28N4O5S — CID 19315732
3-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 19315732) has the molecular formula C34H28N4O5S and a molecular weight of 604.69 g/mol. Its IUPAC name is 3-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 3-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19315732 |
| Molecular Formula | C34H28N4O5S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 3-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C34H28N4O5S/c1-21(31(39)36-25-12-7-11-23(17-25)34(42)43)44-27-14-8-13-26(19-27)37-33(41)30(38-32(40)22-9-3-2-4-10-22)18-24-20-35-29-16-6-5-15-28(24)29/h2-21,35H,1H3,(H,36,39)(H,37,41)(H,38,40)(H,42,43)/b30-18- |
| InChIKey | AWENBYCQGYZKBJ-YKQZZPSBSA-N |
| XLogP | 6.39 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|