C34H29FN4O3S — CID 19315864
N-[(Z)-3-[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315864) has the molecular formula C34H29FN4O3S and a molecular weight of 592.70 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315864 |
| Molecular Formula | C34H29FN4O3S |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C34H29FN4O3S/c1-2-31(34(42)37-25-17-15-24(35)16-18-25)43-27-12-8-11-26(20-27)38-33(41)30(39-32(40)22-9-4-3-5-10-22)19-23-21-36-29-14-7-6-13-28(23)29/h3-21,31,36H,2H2,1H3,(H,37,42)(H,38,41)(H,39,40)/b30-19- |
| InChIKey | SACFTLAPYJTHCQ-FSGOGVSDSA-N |
| XLogP | 7.23 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|