C38H38N4O4S — CID 19315872
N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315872) has the molecular formula C38H38N4O4S and a molecular weight of 646.81 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315872 |
| Molecular Formula | C38H38N4O4S |
| Molecular Weight | 646.81 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C/c3c[nH]c4ccccc34)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H38N4O4S/c1-3-5-22-46-30-20-18-28(19-21-30)40-38(45)35(4-2)47-31-15-11-14-29(24-31)41-37(44)34(42-36(43)26-12-7-6-8-13-26)23-27-25-39-33-17-10-9-16-32(27)33/h6-21,23-25,35,39H,3-5,22H2,1-2H3,(H,40,45)(H,41,44)(H,42,43)/b34-23- |
| InChIKey | FRPORNHJZIRXPB-XSVYLIDLSA-N |
| XLogP | 8.27 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.81 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|