C38H36N4O5S — CID 19315744
butyl 4-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 19315744) has the molecular formula C38H36N4O5S and a molecular weight of 660.80 g/mol. Its IUPAC name is butyl 4-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 19315744 |
| Molecular Formula | C38H36N4O5S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | butyl 4-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3c[nH]c4ccccc34)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H36N4O5S/c1-3-4-21-47-38(46)27-17-19-29(20-18-27)40-35(43)25(2)48-31-14-10-13-30(23-31)41-37(45)34(42-36(44)26-11-6-5-7-12-26)22-28-24-39-33-16-9-8-15-32(28)33/h5-20,22-25,39H,3-4,21H2,1-2H3,(H,40,43)(H,41,45)(H,42,44)/b34-22- |
| InChIKey | CXZQSLBLWCGJRB-VQNDASPWSA-N |
| XLogP | 7.65 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|