C34H27ClN4O5S — CID 19315729
5-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 19315729) has the molecular formula C34H27ClN4O5S and a molecular weight of 639.13 g/mol. Its IUPAC name is 5-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19315729 |
| Molecular Formula | C34H27ClN4O5S |
| Molecular Weight | 639.13 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | 5-[2-[3-[[(Z)-2-benzamido-3-(1H-indol-3-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H27ClN4O5S/c1-20(31(40)37-24-14-15-28(35)27(18-24)34(43)44)45-25-11-7-10-23(17-25)38-33(42)30(39-32(41)21-8-3-2-4-9-21)16-22-19-36-29-13-6-5-12-26(22)29/h2-20,36H,1H3,(H,37,40)(H,38,42)(H,39,41)(H,43,44)/b30-16- |
| InChIKey | KCATXMJXPUNWGZ-UHBFCERESA-N |
| XLogP | 7.05 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.13 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|