C35H32ClN3O8S — CID 19314001
5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 19314001) has the molecular formula C35H32ClN3O8S and a molecular weight of 690.17 g/mol. Its IUPAC name is 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19314001 |
| Molecular Formula | C35H32ClN3O8S |
| Molecular Weight | 690.17 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C)C(=O)Nc2ccc(Cl)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C35H32ClN3O8S/c1-20(32(40)37-24-13-14-27(36)26(18-24)35(43)44)48-25-12-8-11-23(17-25)38-34(42)28(39-33(41)21-9-6-5-7-10-21)15-22-16-30(46-3)31(47-4)19-29(22)45-2/h5-20H,1-4H3,(H,37,40)(H,38,42)(H,39,41)(H,43,44)/b28-15+ |
| InChIKey | GORVDRQLZPZEFH-RWPZCVJISA-N |
| XLogP | 6.59 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.17 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|