C34H30ClN3O7S — CID 21385860
5-[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 21385860) has the molecular formula C34H30ClN3O7S and a molecular weight of 660.15 g/mol. Its IUPAC name is 5-[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 21385860 |
| Molecular Formula | C34H30ClN3O7S |
| Molecular Weight | 660.15 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | 5-[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C)C(=O)Nc3ccc(Cl)c(C(=O)O)c3)cc2)c1 |
| InChI | InChI=1S/C34H30ClN3O7S/c1-20(31(39)37-24-11-15-28(35)27(19-24)34(42)43)46-26-13-9-23(10-14-26)36-33(41)29(38-32(40)21-7-5-4-6-8-21)18-22-17-25(44-2)12-16-30(22)45-3/h4-20H,1-3H3,(H,36,41)(H,37,39)(H,38,40)(H,42,43)/b29-18- |
| InChIKey | WBTPYFPLVMNZBF-MIXAMLLLSA-N |
| XLogP | 6.58 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.15 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|