C32H24Cl3N3O5S — CID 21385020
5-[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 21385020) has the molecular formula C32H24Cl3N3O5S and a molecular weight of 668.99 g/mol. Its IUPAC name is 5-[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 21385020 |
| Molecular Formula | C32H24Cl3N3O5S |
| Molecular Weight | 668.99 g/mol |
| Exact Mass | 667.05 |
| IUPAC Name | 5-[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H24Cl3N3O5S/c1-18(29(39)37-23-11-14-26(34)25(17-23)32(42)43)44-24-12-9-22(10-13-24)36-31(41)28(15-20-7-8-21(33)16-27(20)35)38-30(40)19-5-3-2-4-6-19/h2-18H,1H3,(H,36,41)(H,37,39)(H,38,40)(H,42,43)/b28-15- |
| InChIKey | PLJOUARLTITJAM-MBTHVWNTSA-N |
| XLogP | 7.87 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.99 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|