C32H25ClN4O7S — CID 22188558
5-[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 22188558) has the molecular formula C32H25ClN4O7S and a molecular weight of 645.09 g/mol. Its IUPAC name is 5-[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 22188558 |
| Molecular Formula | C32H25ClN4O7S |
| Molecular Weight | 645.09 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 5-[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H25ClN4O7S/c1-19(29(38)35-23-11-16-27(33)26(18-23)32(41)42)45-25-14-9-22(10-15-25)34-31(40)28(36-30(39)21-5-3-2-4-6-21)17-20-7-12-24(13-8-20)37(43)44/h2-19H,1H3,(H,34,40)(H,35,38)(H,36,39)(H,41,42)/b28-17- |
| InChIKey | HSBZZJWAWKFHDU-QRQIAZFYSA-N |
| XLogP | 6.48 |
| TPSA | 167.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.09 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|