C31H24Cl2N4O5S — CID 22188517
N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188517) has the molecular formula C31H24Cl2N4O5S and a molecular weight of 635.53 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188517 |
| Molecular Formula | C31H24Cl2N4O5S |
| Molecular Weight | 635.53 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,3-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C31H24Cl2N4O5S/c1-19(29(38)35-26-9-5-8-25(32)28(26)33)43-24-16-12-22(13-17-24)34-31(40)27(36-30(39)21-6-3-2-4-7-21)18-20-10-14-23(15-11-20)37(41)42/h2-19H,1H3,(H,34,40)(H,35,38)(H,36,39)/b27-18- |
| InChIKey | CUWQGRJVLQJTKB-IMRQLAEWSA-N |
| XLogP | 7.43 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.53 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|