C32H28N4O5S — CID 21383544
N-[(Z)-3-[4-[1-(2-methyl-4-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21383544) has the molecular formula C32H28N4O5S and a molecular weight of 580.67 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2-methyl-4-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2-methyl-4-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21383544 |
| Molecular Formula | C32H28N4O5S |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2-methyl-4-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(C)Sc1ccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N4O5S/c1-21-19-26(36(40)41)15-18-28(21)34-30(37)22(2)42-27-16-13-25(14-17-27)33-32(39)29(20-23-9-5-3-6-10-23)35-31(38)24-11-7-4-8-12-24/h3-20,22H,1-2H3,(H,33,39)(H,34,37)(H,35,38)/b29-20- |
| InChIKey | FVOHMUSQWJPNIB-BRPDVVIDSA-N |
| XLogP | 6.43 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|