C31H23Cl4N3O3S — CID 19306763
N-[(E)-3-[3-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,4-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306763) has the molecular formula C31H23Cl4N3O3S and a molecular weight of 659.42 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,4-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,4-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306763 |
| Molecular Formula | C31H23Cl4N3O3S |
| Molecular Weight | 659.42 g/mol |
| Exact Mass | 657.02 |
| IUPAC Name | N-[(E)-3-[3-[1-(3,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,4-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H23Cl4N3O3S/c1-18(29(39)36-23-12-13-25(33)27(35)17-23)42-24-9-5-8-22(16-24)37-31(41)28(14-20-10-11-21(32)15-26(20)34)38-30(40)19-6-3-2-4-7-19/h2-18H,1H3,(H,36,39)(H,37,41)(H,38,40)/b28-14+ |
| InChIKey | BFTKSJPCCIIYFJ-CCVNUDIWSA-N |
| XLogP | 8.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.42 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|