C33H29Cl2N3O3S — CID 19306786
N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306786) has the molecular formula C33H29Cl2N3O3S and a molecular weight of 618.59 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306786 |
| Molecular Formula | C33H29Cl2N3O3S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H29Cl2N3O3S/c1-20-9-7-10-21(2)30(20)38-31(39)22(3)42-27-14-8-13-26(19-27)36-33(41)29(17-24-15-16-25(34)18-28(24)35)37-32(40)23-11-5-4-6-12-23/h4-19,22H,1-3H3,(H,36,41)(H,37,40)(H,38,39)/b29-17+ |
| InChIKey | LRMBAUYUPUABET-STBIYBPSSA-N |
| XLogP | 8.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|