C33H28Cl2N4O4S — CID 19307095
N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307095) has the molecular formula C33H28Cl2N4O4S and a molecular weight of 647.58 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307095 |
| Molecular Formula | C33H28Cl2N4O4S |
| Molecular Weight | 647.58 g/mol |
| Exact Mass | 646.12 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H28Cl2N4O4S/c1-20(31(41)37-24-16-14-23(15-17-24)36-21(2)40)44-26-11-6-10-25(18-26)38-33(43)30(19-27-28(34)12-7-13-29(27)35)39-32(42)22-8-4-3-5-9-22/h3-20H,1-2H3,(H,36,40)(H,37,41)(H,38,43)(H,39,42)/b30-19+ |
| InChIKey | AXZFRBIITSAERK-NDZAJKAJSA-N |
| XLogP | 7.48 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.58 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|