C31H26Cl2N4O5S2 — CID 19306520
N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19306520) has the molecular formula C31H26Cl2N4O5S2 and a molecular weight of 669.61 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306520 |
| Molecular Formula | C31H26Cl2N4O5S2 |
| Molecular Weight | 669.61 g/mol |
| Exact Mass | 668.07 |
| IUPAC Name | N-[(E)-1-(2,3-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C31H26Cl2N4O5S2/c1-19(29(38)35-22-13-15-25(16-14-22)44(34,41)42)43-24-11-6-10-23(18-24)36-31(40)27(17-21-9-5-12-26(32)28(21)33)37-30(39)20-7-3-2-4-8-20/h2-19H,1H3,(H,35,38)(H,36,40)(H,37,39)(H2,34,41,42)/b27-17+ |
| InChIKey | KSKCFUICHHAMGA-WPWMEQJKSA-N |
| XLogP | 6.17 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|