C31H27ClN4O5S2 — CID 19305944
N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19305944) has the molecular formula C31H27ClN4O5S2 and a molecular weight of 635.17 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305944 |
| Molecular Formula | C31H27ClN4O5S2 |
| Molecular Weight | 635.17 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C/c2ccc(Cl)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C31H27ClN4O5S2/c1-20(29(37)34-24-14-16-27(17-15-24)43(33,40)41)42-26-9-5-8-25(19-26)35-31(39)28(18-21-10-12-23(32)13-11-21)36-30(38)22-6-3-2-4-7-22/h2-20H,1H3,(H,34,37)(H,35,39)(H,36,38)(H2,33,40,41)/b28-18- |
| InChIKey | OPBLMWYWRPINSN-VEILYXNESA-N |
| XLogP | 5.52 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.17 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|