C34H34N4O5S2 — CID 19311128
N-[(E)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19311128) has the molecular formula C34H34N4O5S2 and a molecular weight of 642.80 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311128 |
| Molecular Formula | C34H34N4O5S2 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylanilino]-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(C(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C34H34N4O5S2/c1-22(2)25-14-12-24(13-15-25)20-31(38-33(40)26-8-5-4-6-9-26)34(41)37-28-10-7-11-29(21-28)44-23(3)32(39)36-27-16-18-30(19-17-27)45(35,42)43/h4-23H,1-3H3,(H,36,39)(H,37,41)(H,38,40)(H2,35,42,43)/b31-20+ |
| InChIKey | CJFJREYSIYPMMZ-AJBULDERSA-N |
| XLogP | 5.99 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|