C38H35N5O5S2 — CID 19308752
N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19308752) has the molecular formula C38H35N5O5S2 and a molecular weight of 705.86 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308752 |
| Molecular Formula | C38H35N5O5S2 |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.21 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(S(N)(=O)=O)cc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H35N5O5S2/c1-43(2)31-20-16-26(17-21-31)24-34(42-36(44)28-12-7-4-8-13-28)37(45)41-30-14-9-15-32(25-30)49-35(27-10-5-3-6-11-27)38(46)40-29-18-22-33(23-19-29)50(39,47)48/h3-25,35H,1-2H3,(H,40,46)(H,41,45)(H,42,44)(H2,39,47,48)/b34-24+ |
| InChIKey | HADYHGYJXZHTLT-JGRMKTMXSA-N |
| XLogP | 6.28 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|