C36H30N4O5S2 — CID 21383697
N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21383697) has the molecular formula C36H30N4O5S2 and a molecular weight of 662.79 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21383697 |
| Molecular Formula | C36H30N4O5S2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccccc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N4O5S2/c37-47(44,45)31-22-18-29(19-23-31)39-36(43)33(26-12-6-2-7-13-26)46-30-20-16-28(17-21-30)38-35(42)32(24-25-10-4-1-5-11-25)40-34(41)27-14-8-3-9-15-27/h1-24,33H,(H,38,42)(H,39,43)(H,40,41)(H2,37,44,45)/b32-24- |
| InChIKey | YSAYPLKLYHSBBW-TZHWMEPESA-N |
| XLogP | 6.22 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|