C37H32N4O5S2 — CID 22189755
N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22189755) has the molecular formula C37H32N4O5S2 and a molecular weight of 676.82 g/mol. Its IUPAC name is N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189755 |
| Molecular Formula | C37H32N4O5S2 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2ccc(S(N)(=O)=O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32N4O5S2/c1-25-10-8-9-15-28(25)24-33(41-35(42)27-13-6-3-7-14-27)36(43)39-29-16-20-31(21-17-29)47-34(26-11-4-2-5-12-26)37(44)40-30-18-22-32(23-19-30)48(38,45)46/h2-24,34H,1H3,(H,39,43)(H,40,44)(H,41,42)(H2,38,45,46)/b33-24- |
| InChIKey | DLHAFVGKNURUIG-GIBOGKFOSA-N |
| XLogP | 6.52 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|