C40H32N4O5S2 — CID 19311632
N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19311632) has the molecular formula C40H32N4O5S2 and a molecular weight of 712.85 g/mol. Its IUPAC name is N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311632 |
| Molecular Formula | C40H32N4O5S2 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 712.18 |
| IUPAC Name | N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cccc4ccccc34)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H32N4O5S2/c41-51(48,49)34-23-21-31(22-24-34)42-40(47)37(28-12-3-1-4-13-28)50-33-19-10-18-32(26-33)43-39(46)36(44-38(45)29-14-5-2-6-15-29)25-30-17-9-16-27-11-7-8-20-35(27)30/h1-26,37H,(H,42,47)(H,43,46)(H,44,45)(H2,41,48,49)/b36-25+ |
| InChIKey | LTRFJLKSKSGPDR-YRRMYEEHSA-N |
| XLogP | 7.37 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|