C41H33N3O3S — CID 19311596
N-[(E)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19311596) has the molecular formula C41H33N3O3S and a molecular weight of 647.80 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311596 |
| Molecular Formula | C41H33N3O3S |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | N-[(E)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cccc4ccccc34)NC(=O)c3ccccc3)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C41H33N3O3S/c1-28-13-10-21-33(25-28)43-41(47)38(30-15-4-2-5-16-30)48-35-23-12-22-34(27-35)42-40(46)37(44-39(45)31-17-6-3-7-18-31)26-32-20-11-19-29-14-8-9-24-36(29)32/h2-27,38H,1H3,(H,42,46)(H,43,47)(H,44,45)/b37-26+ |
| InChIKey | FDMZLECVLNVXLC-AVLPFNLUSA-N |
| XLogP | 9.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|