C37H29Cl2N3O3S — CID 19307276
N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307276) has the molecular formula C37H29Cl2N3O3S and a molecular weight of 666.63 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307276 |
| Molecular Formula | C37H29Cl2N3O3S |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H29Cl2N3O3S/c1-24-11-8-16-27(21-24)41-37(45)34(25-12-4-2-5-13-25)46-29-18-9-17-28(22-29)40-36(44)33(23-30-31(38)19-10-20-32(30)39)42-35(43)26-14-6-3-7-15-26/h2-23,34H,1H3,(H,40,44)(H,41,45)(H,42,43)/b33-23+ |
| InChIKey | ACKFVVIORGMXQJ-GZZLJNBRSA-N |
| XLogP | 9.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|