C39H31Cl2N3O5S — CID 19307282
ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 19307282) has the molecular formula C39H31Cl2N3O5S and a molecular weight of 724.67 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19307282 |
| Molecular Formula | C39H31Cl2N3O5S |
| Molecular Weight | 724.67 g/mol |
| Exact Mass | 723.14 |
| IUPAC Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H31Cl2N3O5S/c1-2-49-39(48)27-19-21-28(22-20-27)42-38(47)35(25-11-5-3-6-12-25)50-30-16-9-15-29(23-30)43-37(46)34(24-31-32(40)17-10-18-33(31)41)44-36(45)26-13-7-4-8-14-26/h3-24,35H,2H2,1H3,(H,42,47)(H,43,46)(H,44,45)/b34-24+ |
| InChIKey | KQLFKEOERGZHFN-JGRMKTMXSA-N |
| XLogP | 9.05 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|