C39H32ClN3O5S — CID 19306130
ethyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 19306130) has the molecular formula C39H32ClN3O5S and a molecular weight of 690.22 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19306130 |
| Molecular Formula | C39H32ClN3O5S |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.18 |
| IUPAC Name | ethyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C/c3ccc(Cl)cc3)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H32ClN3O5S/c1-2-48-39(47)29-18-22-31(23-19-29)41-38(46)35(27-10-5-3-6-11-27)49-33-15-9-14-32(25-33)42-37(45)34(24-26-16-20-30(40)21-17-26)43-36(44)28-12-7-4-8-13-28/h3-25,35H,2H2,1H3,(H,41,46)(H,42,45)(H,43,44)/b34-24- |
| InChIKey | ZHRJAKTXKZSBHF-BCJTWVECSA-N |
| XLogP | 8.40 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|