C42H39N3O8S — CID 19314194
ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 19314194) has the molecular formula C42H39N3O8S and a molecular weight of 745.85 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19314194 |
| Molecular Formula | C42H39N3O8S |
| Molecular Weight | 745.85 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)cc3OC)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39N3O8S/c1-5-53-42(49)29-19-21-31(22-20-29)43-41(48)38(27-13-8-6-9-14-27)54-33-18-12-17-32(25-33)44-40(47)34(45-39(46)28-15-10-7-11-16-28)23-30-24-36(51-3)37(52-4)26-35(30)50-2/h6-26,38H,5H2,1-4H3,(H,43,48)(H,44,47)(H,45,46)/b34-23+ |
| InChIKey | WACQPJCNIGYPQE-PPFNPFNJSA-N |
| XLogP | 7.77 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.85 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|