C41H37N3O7S — CID 19314195
N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314195) has the molecular formula C41H37N3O7S and a molecular weight of 715.83 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314195 |
| Molecular Formula | C41H37N3O7S |
| Molecular Weight | 715.83 g/mol |
| Exact Mass | 715.24 |
| IUPAC Name | N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(C(C)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C41H37N3O7S/c1-26(45)27-18-20-31(21-19-27)42-41(48)38(28-12-7-5-8-13-28)52-33-17-11-16-32(24-33)43-40(47)34(44-39(46)29-14-9-6-10-15-29)22-30-23-36(50-3)37(51-4)25-35(30)49-2/h5-25,38H,1-4H3,(H,42,48)(H,43,47)(H,44,46)/b34-22+ |
| InChIKey | YLUBKSXPMBGFSK-PPOKSSTKSA-N |
| XLogP | 7.80 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.83 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|