C38H32N4O6S — CID 19315667
4-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide (PubChem CID 19315667) has the molecular formula C38H32N4O6S and a molecular weight of 672.76 g/mol. Its IUPAC name is 4-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 19315667 |
| Molecular Formula | C38H32N4O6S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
| SMILES | COc1cc(O)ccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(C(N)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C38H32N4O6S/c1-48-33-23-30(43)20-17-27(33)21-32(42-36(45)26-11-6-3-7-12-26)37(46)41-29-13-8-14-31(22-29)49-34(24-9-4-2-5-10-24)38(47)40-28-18-15-25(16-19-28)35(39)44/h2-23,34,43H,1H3,(H2,39,44)(H,40,47)(H,41,46)(H,42,45)/b32-21+ |
| InChIKey | TXEVWEJWTCYWDR-RUMWWMSVSA-N |
| XLogP | 6.38 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|