C39H35N3O5S — CID 19307853
N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[2-(4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307853) has the molecular formula C39H35N3O5S and a molecular weight of 657.79 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[2-(4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[2-(4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307853 |
| Molecular Formula | C39H35N3O5S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[2-(4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(C)cc3)c3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C39H35N3O5S/c1-26-17-20-30(21-18-26)40-39(45)36(27-11-6-4-7-12-27)48-33-16-10-15-31(24-33)41-38(44)34(42-37(43)28-13-8-5-9-14-28)23-29-19-22-32(46-2)25-35(29)47-3/h4-25,36H,1-3H3,(H,40,45)(H,41,44)(H,42,43)/b34-23+ |
| InChIKey | KTEQNDXAKMZINH-PPFNPFNJSA-N |
| XLogP | 7.89 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|