C45H39N3O7S — CID 19314215
N-[(E)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314215) has the molecular formula C45H39N3O7S and a molecular weight of 765.89 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314215 |
| Molecular Formula | C45H39N3O7S |
| Molecular Weight | 765.89 g/mol |
| Exact Mass | 765.25 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C45H39N3O7S/c1-52-39-29-41(54-3)40(53-2)27-32(39)26-38(48-43(49)31-16-9-5-10-17-31)44(50)47-34-18-13-21-37(28-34)56-42(30-14-7-4-8-15-30)45(51)46-33-22-24-36(25-23-33)55-35-19-11-6-12-20-35/h4-29,42H,1-3H3,(H,46,51)(H,47,50)(H,48,49)/b38-26+ |
| InChIKey | VMKAONVJSOPBJL-DZTJYMNTSA-N |
| XLogP | 9.39 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.89 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|