C40H35N3O9S — CID 19314230
5-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 19314230) has the molecular formula C40H35N3O9S and a molecular weight of 733.80 g/mol. Its IUPAC name is 5-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19314230 |
| Molecular Formula | C40H35N3O9S |
| Molecular Weight | 733.80 g/mol |
| Exact Mass | 733.21 |
| IUPAC Name | 5-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C40H35N3O9S/c1-50-33-23-35(52-3)34(51-2)20-26(33)19-31(43-37(45)25-13-8-5-9-14-25)38(46)41-27-15-10-16-29(21-27)53-36(24-11-6-4-7-12-24)39(47)42-28-17-18-32(44)30(22-28)40(48)49/h4-23,36,44H,1-3H3,(H,41,46)(H,42,47)(H,43,45)(H,48,49)/b31-19+ |
| InChIKey | XCEOVUACRANLLV-ZCTHSVRISA-N |
| XLogP | 7.00 |
| TPSA | 172.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.80 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|