C39H32ClN3O7S — CID 19308457
5-[[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid (PubChem CID 19308457) has the molecular formula C39H32ClN3O7S and a molecular weight of 722.22 g/mol. Its IUPAC name is 5-[[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19308457 |
| Molecular Formula | C39H32ClN3O7S |
| Molecular Weight | 722.22 g/mol |
| Exact Mass | 721.16 |
| IUPAC Name | 5-[[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-chlorobenzoic acid |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(Cl)c(C(=O)O)c3)c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C39H32ClN3O7S/c1-49-33-19-16-24(21-34(33)50-2)20-32(43-36(44)26-12-7-4-8-13-26)37(45)41-27-14-9-15-29(22-27)51-35(25-10-5-3-6-11-25)38(46)42-28-17-18-31(40)30(23-28)39(47)48/h3-23,35H,1-2H3,(H,41,45)(H,42,46)(H,43,44)(H,47,48)/b32-20+ |
| InChIKey | BXHOLDHIJXQQOM-UZWMFBFFSA-N |
| XLogP | 7.94 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.22 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|