C38H31Cl2N3O5S — CID 21386171
N-[(Z)-3-[4-[2-(2,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386171) has the molecular formula C38H31Cl2N3O5S and a molecular weight of 712.66 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386171 |
| Molecular Formula | C38H31Cl2N3O5S |
| Molecular Weight | 712.66 g/mol |
| Exact Mass | 711.14 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,5-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3cc(Cl)ccc3Cl)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C38H31Cl2N3O5S/c1-47-33-20-13-24(22-34(33)48-2)21-32(43-36(44)26-11-7-4-8-12-26)37(45)41-28-15-17-29(18-16-28)49-35(25-9-5-3-6-10-25)38(46)42-31-23-27(39)14-19-30(31)40/h3-23,35H,1-2H3,(H,41,45)(H,42,46)(H,43,44)/b32-21- |
| InChIKey | MQTJQPQQCVAJCK-QXPFVDMISA-N |
| XLogP | 8.89 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.66 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|