C39H34ClN3O6S — CID 22190330
N-[(Z)-3-[4-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190330) has the molecular formula C39H34ClN3O6S and a molecular weight of 708.24 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190330 |
| Molecular Formula | C39H34ClN3O6S |
| Molecular Weight | 708.24 g/mol |
| Exact Mass | 707.19 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2ccccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H34ClN3O6S/c1-47-33-24-35(49-3)34(48-2)23-27(33)22-32(43-37(44)26-14-8-5-9-15-26)38(45)41-28-18-20-29(21-19-28)50-36(25-12-6-4-7-13-25)39(46)42-31-17-11-10-16-30(31)40/h4-24,36H,1-3H3,(H,41,45)(H,42,46)(H,43,44)/b32-22- |
| InChIKey | LOKYOWCHIASIKF-JDCMOKTRSA-N |
| XLogP | 8.25 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.24 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|