C41H39N3O7S — CID 22190374
N-[(Z)-3-[4-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190374) has the molecular formula C41H39N3O7S and a molecular weight of 717.84 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190374 |
| Molecular Formula | C41H39N3O7S |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 717.25 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H39N3O7S/c1-5-51-34-19-13-12-18-32(34)43-41(47)38(27-14-8-6-9-15-27)52-31-22-20-30(21-23-31)42-40(46)33(44-39(45)28-16-10-7-11-17-28)24-29-25-36(49-3)37(50-4)26-35(29)48-2/h6-26,38H,5H2,1-4H3,(H,42,46)(H,43,47)(H,44,45)/b33-24- |
| InChIKey | DZQPULPIVBUHEP-GIBOGKFOSA-N |
| XLogP | 7.99 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|