C40H37N3O5S — CID 19309893
N-[(E)-3-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309893) has the molecular formula C40H37N3O5S and a molecular weight of 671.82 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309893 |
| Molecular Formula | C40H37N3O5S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.25 |
| IUPAC Name | N-[(E)-3-[3-[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccccc2OCC)c2ccccc2)c1 |
| InChI | InChI=1S/C40H37N3O5S/c1-3-47-35-24-13-11-20-30(35)26-34(43-38(44)29-18-9-6-10-19-29)39(45)41-31-21-15-22-32(27-31)49-37(28-16-7-5-8-17-28)40(46)42-33-23-12-14-25-36(33)48-4-2/h5-27,37H,3-4H2,1-2H3,(H,41,45)(H,42,46)(H,43,44)/b34-26+ |
| InChIKey | RFVJHMBMLRWLCV-JJNGWGCYSA-N |
| XLogP | 8.37 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|