C40H36N4O5S — CID 19309903
N-[(E)-3-[3-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309903) has the molecular formula C40H36N4O5S and a molecular weight of 684.82 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309903 |
| Molecular Formula | C40H36N4O5S |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | N-[(E)-3-[3-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2ccc(NC(C)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C40H36N4O5S/c1-3-49-36-20-11-10-17-30(36)25-35(44-38(46)29-15-8-5-9-16-29)39(47)43-33-18-12-19-34(26-33)50-37(28-13-6-4-7-14-28)40(48)42-32-23-21-31(22-24-32)41-27(2)45/h4-26,37H,3H2,1-2H3,(H,41,45)(H,42,48)(H,43,47)(H,44,46)/b35-25+ |
| InChIKey | QGDGLMJUHXRVRR-KVQDIILNSA-N |
| XLogP | 7.93 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|